C20H33F — CID 22983403
2-[(E)-3-fluoroprop-2-enyl]-6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 22983403) has the molecular formula C20H33F and a molecular weight of 292.48 g/mol. Its IUPAC name is 2-[(E)-3-fluoroprop-2-enyl]-6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[(E)-3-fluoroprop-2-enyl]-6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 22983403 |
| Molecular Formula | C20H33F |
| Molecular Weight | 292.48 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 2-[(E)-3-fluoroprop-2-enyl]-6-(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CC1CCC(C2CCC3CC(C/C=C/F)CCC3C2)CC1 |
| InChI | InChI=1S/C20H33F/c1-15-4-7-17(8-5-15)19-11-10-18-13-16(3-2-12-21)6-9-20(18)14-19/h2,12,15-20H,3-11,13-14H2,1H3/b12-2+ |
| InChIKey | RHHXGHVMIHOCPQ-SWGQDTFXSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |