C21H20N2O7 — CID 22983425
(5E)-3-[4-(dimethylamino)-2,6-dihydroxyphenyl]-5-[4-(dimethylamino)-2-hydroxy-6-oxocyclohexa-2,4-dien-1-ylidene]-4-hydroxycyclopent-3-ene-1,2-dione (PubChem CID 22983425) has the molecular formula C21H20N2O7 and a molecular weight of 412.40 g/mol. Its IUPAC name is (5E)-3-[4-(dimethylamino)-2,6-dihydroxyphenyl]-5-[4-(dimethylamino)-2-hydroxy-6-oxocyclohexa-2,4-dien-1-ylidene]-4-hydroxycyclopent-3-ene-1,2-dione.
| Compound Name | (5E)-3-[4-(dimethylamino)-2,6-dihydroxyphenyl]-5-[4-(dimethylamino)-2-hydroxy-6-oxocyclohexa-2,4-dien-1-ylidene]-4-hydroxycyclopent-3-ene-1,2-dione |
|---|---|
| PubChem CID | 22983425 |
| Molecular Formula | C21H20N2O7 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (5E)-3-[4-(dimethylamino)-2,6-dihydroxyphenyl]-5-[4-(dimethylamino)-2-hydroxy-6-oxocyclohexa-2,4-dien-1-ylidene]-4-hydroxycyclopent-3-ene-1,2-dione |
| SMILES | CN(C)C1=CC(=O)/C(=C2/C(=O)C(=O)C(c3c(O)cc(N(C)C)cc3O)=C2O)C(O)=C1 |
| InChI | InChI=1S/C21H20N2O7/c1-22(2)9-5-11(24)15(12(25)6-9)17-19(28)18(21(30)20(17)29)16-13(26)7-10(23(3)4)8-14(16)27/h5-8,24-26,28H,1-4H3/b18-16+ |
| InChIKey | PZQAIYRPKIKDLW-FBMGVBCBSA-N |
| XLogP | 1.35 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|