C18H15NO4S3 — CID 2298358
[3-[(Z)-[3-(3-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] methanesulfonate (PubChem CID 2298358) has the molecular formula C18H15NO4S3 and a molecular weight of 405.52 g/mol. Its IUPAC name is [3-[(Z)-[3-(3-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[(Z)-[3-(3-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 2298358 |
| Molecular Formula | C18H15NO4S3 |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | [3-[(Z)-[3-(3-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] methanesulfonate |
| SMILES | Cc1cccc(N2C(=O)/C(=C/c3cccc(OS(C)(=O)=O)c3)SC2=S)c1 |
| InChI | InChI=1S/C18H15NO4S3/c1-12-5-3-7-14(9-12)19-17(20)16(25-18(19)24)11-13-6-4-8-15(10-13)23-26(2,21)22/h3-11H,1-2H3/b16-11- |
| InChIKey | FZTNAGJLZGUIFU-WJDWOHSUSA-N |
| XLogP | 3.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|