C21H27NO5 — CID 22983876
(8R,9S,13S,14S)-3-(2-methoxyethoxy)-13-methyl-2-nitro-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 22983876) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-(2-methoxyethoxy)-13-methyl-2-nitro-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-3-(2-methoxyethoxy)-13-methyl-2-nitro-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 22983876 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (8R,9S,13S,14S)-3-(2-methoxyethoxy)-13-methyl-2-nitro-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | COCCOc1cc2c(cc1[N+](=O)[O-])[C@H]1CC[C@]3(C)C(=O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C21H27NO5/c1-21-8-7-14-15(17(21)5-6-20(21)23)4-3-13-11-19(27-10-9-26-2)18(22(24)25)12-16(13)14/h11-12,14-15,17H,3-10H2,1-2H3/t14-,15+,17-,21-/m0/s1 |
| InChIKey | YGFZAQQGSAFEQH-KJOVKWNASA-N |
| XLogP | 4.05 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|