About N-benzyl-2-(2,4-dimethylphenoxy)ethanamine
N-benzyl-2-(2,4-dimethylphenoxy)ethanamine (PubChem CID 2298404) has the molecular formula C17H21NO
and a molecular weight of 255.36 g/mol. Its IUPAC name is N-benzyl-2-(2,4-dimethylphenoxy)ethanamine.
Molecular Properties
| Compound Name | N-benzyl-2-(2,4-dimethylphenoxy)ethanamine |
| PubChem CID | 2298404 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N-benzyl-2-(2,4-dimethylphenoxy)ethanamine |
| SMILES | Cc1ccc(OCCNCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C17H21NO/c1-14-8-9-17(15(2)12-14)19-11-10-18-13-16-6-4-3-5-7-16/h3-9,12,18H,10-11,13H2,1-2H3 |
| InChIKey | MSADMIDVXOMMAV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-(2,4-dimethylphenoxy)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(2,4-dimethylphenoxy)ethanamine?
The IUPAC name of N-benzyl-2-(2,4-dimethylphenoxy)ethanamine (CID 2298404) is N-benzyl-2-(2,4-dimethylphenoxy)ethanamine.
What is the SMILES notation for N-benzyl-2-(2,4-dimethylphenoxy)ethanamine?
The canonical SMILES for N-benzyl-2-(2,4-dimethylphenoxy)ethanamine is Cc1ccc(OCCNCc2ccccc2)c(C)c1.
What is the InChIKey of N-benzyl-2-(2,4-dimethylphenoxy)ethanamine?
The InChIKey is MSADMIDVXOMMAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO/c1-14-8-9-17(15(2)12-14)19-11-10-18-13-16-6-4-3-5-7-16/h3-9,12,18H,10-11,13H2,1-2H3.
What are the key properties of N-benzyl-2-(2,4-dimethylphenoxy)ethanamine?
N-benzyl-2-(2,4-dimethylphenoxy)ethanamine has a molecular weight of 255.36 g/mol, XLogP of 3.47, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(2,4-dimethylphenoxy)ethanamine is sourced from PubChem (CID 2298404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).