About 1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one
1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one (PubChem CID 22984653) has the molecular formula C16H28N2O
and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one.
Molecular Properties
| Compound Name | 1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one |
| PubChem CID | 22984653 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one |
| SMILES | CNC1CC(C)(C)CCN(C2CCC=CCC2)C1=O |
| InChI | InChI=1S/C16H28N2O/c1-16(2)10-11-18(15(19)14(12-16)17-3)13-8-6-4-5-7-9-13/h4-5,13-14,17H,6-12H2,1-3H3 |
| InChIKey | BZUMJSMLIWLNKG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one?
The IUPAC name of 1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one (CID 22984653) is 1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one.
What is the SMILES notation for 1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one?
The canonical SMILES for 1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one is CNC1CC(C)(C)CCN(C2CCC=CCC2)C1=O.
What is the InChIKey of 1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one?
The InChIKey is BZUMJSMLIWLNKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O/c1-16(2)10-11-18(15(19)14(12-16)17-3)13-8-6-4-5-7-9-13/h4-5,13-14,17H,6-12H2,1-3H3.
What are the key properties of 1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one?
1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one has a molecular weight of 264.41 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohept-4-en-1-yl-5,5-dimethyl-3-(methylamino)azepan-2-one is sourced from PubChem (CID 22984653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).