About 4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one
4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one (PubChem CID 22984954) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one.
Molecular Properties
| Compound Name | 4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one |
| PubChem CID | 22984954 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one |
| SMILES | CNC1COCCN(C2C=CC2)C1=O |
| InChI | InChI=1S/C10H16N2O2/c1-11-9-7-14-6-5-12(10(9)13)8-3-2-4-8/h2-3,8-9,11H,4-7H2,1H3 |
| InChIKey | QRZQJZCLORDDEO-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one?
The IUPAC name of 4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one (CID 22984954) is 4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one.
What is the SMILES notation for 4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one?
The canonical SMILES for 4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one is CNC1COCCN(C2C=CC2)C1=O.
What is the InChIKey of 4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one?
The InChIKey is QRZQJZCLORDDEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-11-9-7-14-6-5-12(10(9)13)8-3-2-4-8/h2-3,8-9,11H,4-7H2,1H3.
What are the key properties of 4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one?
4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one has a molecular weight of 196.25 g/mol, XLogP of -0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclobut-2-en-1-yl-6-(methylamino)-1,4-oxazepan-5-one is sourced from PubChem (CID 22984954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).