About 4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one
4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one (PubChem CID 22984980) has the molecular formula C10H21N3O3S
and a molecular weight of 263.36 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one.
Molecular Properties
| Compound Name | 4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one |
| PubChem CID | 22984980 |
| Molecular Formula | C10H21N3O3S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one |
| SMILES | CNC1CS(=O)(=O)CCN(CCN(C)C)C1=O |
| InChI | InChI=1S/C10H21N3O3S/c1-11-9-8-17(15,16)7-6-13(10(9)14)5-4-12(2)3/h9,11H,4-8H2,1-3H3 |
| InChIKey | LSTIGJRFTHZRRW-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one?
The IUPAC name of 4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one (CID 22984980) is 4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one.
What is the SMILES notation for 4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one?
The canonical SMILES for 4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one is CNC1CS(=O)(=O)CCN(CCN(C)C)C1=O.
What is the InChIKey of 4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one?
The InChIKey is LSTIGJRFTHZRRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O3S/c1-11-9-8-17(15,16)7-6-13(10(9)14)5-4-12(2)3/h9,11H,4-8H2,1-3H3.
What are the key properties of 4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one?
4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one has a molecular weight of 263.36 g/mol, XLogP of -1.61, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(dimethylamino)ethyl]-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one is sourced from PubChem (CID 22984980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).