C9H16N2OS — CID 22985041
4-cyclopropyl-6-(methylamino)-1,4-thiazepan-5-one (PubChem CID 22985041) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 4-cyclopropyl-6-(methylamino)-1,4-thiazepan-5-one.
| Compound Name | 4-cyclopropyl-6-(methylamino)-1,4-thiazepan-5-one |
|---|---|
| PubChem CID | 22985041 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4-cyclopropyl-6-(methylamino)-1,4-thiazepan-5-one |
| SMILES | CNC1CSCCN(C2CC2)C1=O |
| InChI | InChI=1S/C9H16N2OS/c1-10-8-6-13-5-4-11(9(8)12)7-2-3-7/h7-8,10H,2-6H2,1H3 |
| InChIKey | AATDPRUHKDLMST-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |