About 4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one
4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one (PubChem CID 22985211) has the molecular formula C10H20N2O3S
and a molecular weight of 248.35 g/mol. Its IUPAC name is 4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one.
Molecular Properties
| Compound Name | 4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one |
| PubChem CID | 22985211 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one |
| SMILES | CNC1CS(=O)(=O)CCN(C(C)(C)C)C1=O |
| InChI | InChI=1S/C10H20N2O3S/c1-10(2,3)12-5-6-16(14,15)7-8(11-4)9(12)13/h8,11H,5-7H2,1-4H3 |
| InChIKey | GBFTVNCLLLZWAN-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one?
The IUPAC name of 4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one (CID 22985211) is 4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one.
What is the SMILES notation for 4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one?
The canonical SMILES for 4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one is CNC1CS(=O)(=O)CCN(C(C)(C)C)C1=O.
What is the InChIKey of 4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one?
The InChIKey is GBFTVNCLLLZWAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3S/c1-10(2,3)12-5-6-16(14,15)7-8(11-4)9(12)13/h8,11H,5-7H2,1-4H3.
What are the key properties of 4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one?
4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one has a molecular weight of 248.35 g/mol, XLogP of -0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-6-(methylamino)-1,1-dioxo-1,4-thiazepan-5-one is sourced from PubChem (CID 22985211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).