About 6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one
6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one (PubChem CID 22985217) has the molecular formula C11H20N2O3S2
and a molecular weight of 292.43 g/mol. Its IUPAC name is 6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one.
Molecular Properties
| Compound Name | 6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one |
| PubChem CID | 22985217 |
| Molecular Formula | C11H20N2O3S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one |
| SMILES | CNC1CS(=O)(=O)CCN(CC2CCCS2)C1=O |
| InChI | InChI=1S/C11H20N2O3S2/c1-12-10-8-18(15,16)6-4-13(11(10)14)7-9-3-2-5-17-9/h9-10,12H,2-8H2,1H3 |
| InChIKey | TZHIHSCMRWCYBZ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one?
The IUPAC name of 6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one (CID 22985217) is 6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one.
What is the SMILES notation for 6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one?
The canonical SMILES for 6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one is CNC1CS(=O)(=O)CCN(CC2CCCS2)C1=O.
What is the InChIKey of 6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one?
The InChIKey is TZHIHSCMRWCYBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3S2/c1-12-10-8-18(15,16)6-4-13(11(10)14)7-9-3-2-5-17-9/h9-10,12H,2-8H2,1H3.
What are the key properties of 6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one?
6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one has a molecular weight of 292.43 g/mol, XLogP of -0.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methylamino)-1,1-dioxo-4-(thiolan-2-ylmethyl)-1,4-thiazepan-5-one is sourced from PubChem (CID 22985217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).