C24H28N6O4S — CID 22985352
4-[[5-[[3-(benzylsulfonylamino)-2-oxoazepan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]methyl]benzenecarboximidamide (PubChem CID 22985352) has the molecular formula C24H28N6O4S and a molecular weight of 496.59 g/mol. Its IUPAC name is 4-[[5-[[3-(benzylsulfonylamino)-2-oxoazepan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]methyl]benzenecarboximidamide.
| Compound Name | 4-[[5-[[3-(benzylsulfonylamino)-2-oxoazepan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 22985352 |
| Molecular Formula | C24H28N6O4S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 4-[[5-[[3-(benzylsulfonylamino)-2-oxoazepan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cc2noc(CN3CCCCC(NS(=O)(=O)Cc4ccccc4)C3=O)n2)cc1 |
| InChI | InChI=1S/C24H28N6O4S/c25-23(26)19-11-9-17(10-12-19)14-21-27-22(34-28-21)15-30-13-5-4-8-20(24(30)31)29-35(32,33)16-18-6-2-1-3-7-18/h1-3,6-7,9-12,20,29H,4-5,8,13-16H2,(H3,25,26) |
| InChIKey | VLCYGCBWIJHRCI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|