C24H31N5O6S — CID 22985411
N-[(4-carbamimidoylphenyl)methyl]-2-[3-[(2,5-dimethoxyphenyl)sulfonylamino]-2-oxoazepan-1-yl]acetamide (PubChem CID 22985411) has the molecular formula C24H31N5O6S and a molecular weight of 517.61 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[3-[(2,5-dimethoxyphenyl)sulfonylamino]-2-oxoazepan-1-yl]acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[3-[(2,5-dimethoxyphenyl)sulfonylamino]-2-oxoazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 22985411 |
| Molecular Formula | C24H31N5O6S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[3-[(2,5-dimethoxyphenyl)sulfonylamino]-2-oxoazepan-1-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CN2CCCCC(NS(=O)(=O)c3cc(OC)ccc3OC)C2=O)cc1 |
| InChI | InChI=1S/C24H31N5O6S/c1-34-18-10-11-20(35-2)21(13-18)36(32,33)28-19-5-3-4-12-29(24(19)31)15-22(30)27-14-16-6-8-17(9-7-16)23(25)26/h6-11,13,19,28H,3-5,12,14-15H2,1-2H3,(H3,25,26)(H,27,30) |
| InChIKey | ALOPDNVJVANFIV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 163.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|