C33H25N3O4 — CID 22985455
3-(4-hydroxycyclopent-2-en-1-yl)-13-[(4-methoxyphenyl)methyl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 22985455) has the molecular formula C33H25N3O4 and a molecular weight of 527.58 g/mol. Its IUPAC name is 3-(4-hydroxycyclopent-2-en-1-yl)-13-[(4-methoxyphenyl)methyl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 3-(4-hydroxycyclopent-2-en-1-yl)-13-[(4-methoxyphenyl)methyl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 22985455 |
| Molecular Formula | C33H25N3O4 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 3-(4-hydroxycyclopent-2-en-1-yl)-13-[(4-methoxyphenyl)methyl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | COc1ccc(CN2C(=O)c3c(c4c5ccccc5n(C5C=CC(O)C5)c4c4[nH]c5ccccc5c34)C2=O)cc1 |
| InChI | InChI=1S/C33H25N3O4/c1-40-21-14-10-18(11-15-21)17-35-32(38)28-26-22-6-2-4-8-24(22)34-30(26)31-27(29(28)33(35)39)23-7-3-5-9-25(23)36(31)19-12-13-20(37)16-19/h2-15,19-20,34,37H,16-17H2,1H3 |
| InChIKey | ODQHVRIOUWLVSB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|