C33H27N3O5 — CID 22985456
3-(3,4-dihydroxycyclopentyl)-13-[(4-methoxyphenyl)methyl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 22985456) has the molecular formula C33H27N3O5 and a molecular weight of 545.60 g/mol. Its IUPAC name is 3-(3,4-dihydroxycyclopentyl)-13-[(4-methoxyphenyl)methyl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 3-(3,4-dihydroxycyclopentyl)-13-[(4-methoxyphenyl)methyl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 22985456 |
| Molecular Formula | C33H27N3O5 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 3-(3,4-dihydroxycyclopentyl)-13-[(4-methoxyphenyl)methyl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | COc1ccc(CN2C(=O)c3c(c4c5ccccc5n(C5CC(O)C(O)C5)c4c4[nH]c5ccccc5c34)C2=O)cc1 |
| InChI | InChI=1S/C33H27N3O5/c1-41-19-12-10-17(11-13-19)16-35-32(39)28-26-20-6-2-4-8-22(20)34-30(26)31-27(29(28)33(35)40)21-7-3-5-9-23(21)36(31)18-14-24(37)25(38)15-18/h2-13,18,24-25,34,37-38H,14-16H2,1H3 |
| InChIKey | XKYYILHANGYJLW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|