C25H27F3N6O2 — CID 22985802
1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 22985802) has the molecular formula C25H27F3N6O2 and a molecular weight of 500.53 g/mol. Its IUPAC name is 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 22985802 |
| Molecular Formula | C25H27F3N6O2 |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H27F3N6O2/c1-36-14-11-20-33-21-22(18-9-2-3-10-19(18)32-23(21)29)34(20)13-5-4-12-30-24(35)31-17-8-6-7-16(15-17)25(26,27)28/h2-3,6-10,15H,4-5,11-14H2,1H3,(H2,29,32)(H2,30,31,35) |
| InChIKey | WCCOENFWMTYVDZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|