About 3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide
3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide (PubChem CID 22986083) has the molecular formula C18H20N2O2S
and a molecular weight of 328.44 g/mol. Its IUPAC name is 3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide.
Molecular Properties
| Compound Name | 3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide |
| PubChem CID | 22986083 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@@H]1C[C@H](S)CN1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C18H20N2O2S/c21-18(20-11-14-10-17(23)12-19-14)13-5-4-8-16(9-13)22-15-6-2-1-3-7-15/h1-9,14,17,19,23H,10-12H2,(H,20,21)/t14-,17-/m0/s1 |
| InChIKey | YMHHVJYSUCDIEE-YOEHRIQHSA-N |
| XLogP | 2.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide?
The IUPAC name of 3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide (CID 22986083) is 3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide.
What is the SMILES notation for 3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide?
The canonical SMILES for 3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide is O=C(NC[C@@H]1C[C@H](S)CN1)c1cccc(Oc2ccccc2)c1.
What is the InChIKey of 3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide?
The InChIKey is YMHHVJYSUCDIEE-YOEHRIQHSA-N. The full InChI is InChI=1S/C18H20N2O2S/c21-18(20-11-14-10-17(23)12-19-14)13-5-4-8-16(9-13)22-15-6-2-1-3-7-15/h1-9,14,17,19,23H,10-12H2,(H,20,21)/t14-,17-/m0/s1.
What are the key properties of 3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide?
3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide has a molecular weight of 328.44 g/mol, XLogP of 2.87, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenoxy-N-[[(2S,4S)-4-sulfanylpyrrolidin-2-yl]methyl]benzamide is sourced from PubChem (CID 22986083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).