C16H29NO6 — CID 22986343
2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 4-methylperoxy-4-oxobutanoate (PubChem CID 22986343) has the molecular formula C16H29NO6 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 4-methylperoxy-4-oxobutanoate.
| Compound Name | 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 4-methylperoxy-4-oxobutanoate |
|---|---|
| PubChem CID | 22986343 |
| Molecular Formula | C16H29NO6 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)ethyl 4-methylperoxy-4-oxobutanoate |
| SMILES | COOC(=O)CCC(=O)OCCN1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C16H29NO6/c1-15(2)10-12(18)11-16(3,4)17(15)8-9-22-13(19)6-7-14(20)23-21-5/h12,18H,6-11H2,1-5H3 |
| InChIKey | JUSHMSVLVXNKBI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|