C14H23O5P — CID 22986565
cyclopenta-1,4-dien-1-ylmethyl (3,4,5-trimethyloxolan-2-yl)methyl hydrogen phosphate (PubChem CID 22986565) has the molecular formula C14H23O5P and a molecular weight of 302.31 g/mol. Its IUPAC name is cyclopenta-1,4-dien-1-ylmethyl (3,4,5-trimethyloxolan-2-yl)methyl hydrogen phosphate.
| Compound Name | cyclopenta-1,4-dien-1-ylmethyl (3,4,5-trimethyloxolan-2-yl)methyl hydrogen phosphate |
|---|---|
| PubChem CID | 22986565 |
| Molecular Formula | C14H23O5P |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | cyclopenta-1,4-dien-1-ylmethyl (3,4,5-trimethyloxolan-2-yl)methyl hydrogen phosphate |
| SMILES | CC1OC(COP(=O)(O)OCC2=CCC=C2)C(C)C1C |
| InChI | InChI=1S/C14H23O5P/c1-10-11(2)14(19-12(10)3)9-18-20(15,16)17-8-13-6-4-5-7-13/h4,6-7,10-12,14H,5,8-9H2,1-3H3,(H,15,16) |
| InChIKey | CQITZEZIMWXRRN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|