About 3-ethoxy-2,4,5-trimethyloxolane
3-ethoxy-2,4,5-trimethyloxolane (PubChem CID 22986568) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is 3-ethoxy-2,4,5-trimethyloxolane.
Molecular Properties
| Compound Name | 3-ethoxy-2,4,5-trimethyloxolane |
| PubChem CID | 22986568 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 3-ethoxy-2,4,5-trimethyloxolane |
| SMILES | CCOC1C(C)OC(C)C1C |
| InChI | InChI=1S/C9H18O2/c1-5-10-9-6(2)7(3)11-8(9)4/h6-9H,5H2,1-4H3 |
| InChIKey | VLFZBFUYGCVAKM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-2,4,5-trimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2,4,5-trimethyloxolane?
The IUPAC name of 3-ethoxy-2,4,5-trimethyloxolane (CID 22986568) is 3-ethoxy-2,4,5-trimethyloxolane.
What is the SMILES notation for 3-ethoxy-2,4,5-trimethyloxolane?
The canonical SMILES for 3-ethoxy-2,4,5-trimethyloxolane is CCOC1C(C)OC(C)C1C.
What is the InChIKey of 3-ethoxy-2,4,5-trimethyloxolane?
The InChIKey is VLFZBFUYGCVAKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-5-10-9-6(2)7(3)11-8(9)4/h6-9H,5H2,1-4H3.
What are the key properties of 3-ethoxy-2,4,5-trimethyloxolane?
3-ethoxy-2,4,5-trimethyloxolane has a molecular weight of 158.24 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2,4,5-trimethyloxolane is sourced from PubChem (CID 22986568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).