C22H24F2N2O3 — CID 22986955
(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(3-oxo-2,5,6,7,8,9-hexahydrobenzo[7]annulen-4-yl)propanamide (PubChem CID 22986955) has the molecular formula C22H24F2N2O3 and a molecular weight of 402.44 g/mol. Its IUPAC name is (2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(3-oxo-2,5,6,7,8,9-hexahydrobenzo[7]annulen-4-yl)propanamide.
| Compound Name | (2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(3-oxo-2,5,6,7,8,9-hexahydrobenzo[7]annulen-4-yl)propanamide |
|---|---|
| PubChem CID | 22986955 |
| Molecular Formula | C22H24F2N2O3 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(3-oxo-2,5,6,7,8,9-hexahydrobenzo[7]annulen-4-yl)propanamide |
| SMILES | C[C@H](NC(=O)Cc1cc(F)cc(F)c1)C(=O)NC1=C2CCCCCC2=CCC1=O |
| InChI | InChI=1S/C22H24F2N2O3/c1-13(25-20(28)11-14-9-16(23)12-17(24)10-14)22(29)26-21-18-6-4-2-3-5-15(18)7-8-19(21)27/h7,9-10,12-13H,2-6,8,11H2,1H3,(H,25,28)(H,26,29)/t13-/m0/s1 |
| InChIKey | WILWCIKQOFMEEN-ZDUSSCGKSA-N |
| XLogP | 3.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |