About 3,4-diaminoanthracene-1,2-dione
3,4-diaminoanthracene-1,2-dione (PubChem CID 22987002) has the molecular formula C14H10N2O2
and a molecular weight of 238.25 g/mol. Its IUPAC name is 3,4-diaminoanthracene-1,2-dione.
Molecular Properties
| Compound Name | 3,4-diaminoanthracene-1,2-dione |
| PubChem CID | 22987002 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 3,4-diaminoanthracene-1,2-dione |
| SMILES | NC1=C(N)c2cc3ccccc3cc2C(=O)C1=O |
| InChI | InChI=1S/C14H10N2O2/c15-11-9-5-7-3-1-2-4-8(7)6-10(9)13(17)14(18)12(11)16/h1-6H,15-16H2 |
| InChIKey | YFIMBOXJHRGCTH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diaminoanthracene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diaminoanthracene-1,2-dione?
The IUPAC name of 3,4-diaminoanthracene-1,2-dione (CID 22987002) is 3,4-diaminoanthracene-1,2-dione.
What is the SMILES notation for 3,4-diaminoanthracene-1,2-dione?
The canonical SMILES for 3,4-diaminoanthracene-1,2-dione is NC1=C(N)c2cc3ccccc3cc2C(=O)C1=O.
What is the InChIKey of 3,4-diaminoanthracene-1,2-dione?
The InChIKey is YFIMBOXJHRGCTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2/c15-11-9-5-7-3-1-2-4-8(7)6-10(9)13(17)14(18)12(11)16/h1-6H,15-16H2.
What are the key properties of 3,4-diaminoanthracene-1,2-dione?
3,4-diaminoanthracene-1,2-dione has a molecular weight of 238.25 g/mol, XLogP of 1.19, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diaminoanthracene-1,2-dione is sourced from PubChem (CID 22987002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).