About benzene-1,3-diol;triazine
benzene-1,3-diol;triazine (PubChem CID 22987155) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is benzene-1,3-diol;triazine.
Molecular Properties
| Compound Name | benzene-1,3-diol;triazine |
| PubChem CID | 22987155 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | benzene-1,3-diol;triazine |
| SMILES | Oc1cccc(O)c1.c1cnnnc1 |
| InChI | InChI=1S/C6H6O2.C3H3N3/c7-5-2-1-3-6(8)4-5;1-2-4-6-5-3-1/h1-4,7-8H;1-3H |
| InChIKey | CCTKOWFDSRRQEG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzene-1,3-diol;triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diol;triazine?
The IUPAC name of benzene-1,3-diol;triazine (CID 22987155) is benzene-1,3-diol;triazine.
What is the SMILES notation for benzene-1,3-diol;triazine?
The canonical SMILES for benzene-1,3-diol;triazine is Oc1cccc(O)c1.c1cnnnc1.
What is the InChIKey of benzene-1,3-diol;triazine?
The InChIKey is CCTKOWFDSRRQEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C3H3N3/c7-5-2-1-3-6(8)4-5;1-2-4-6-5-3-1/h1-4,7-8H;1-3H.
What are the key properties of benzene-1,3-diol;triazine?
benzene-1,3-diol;triazine has a molecular weight of 191.19 g/mol, XLogP of 0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diol;triazine is sourced from PubChem (CID 22987155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).