C6H3F11O — CID 22987398
1,1,1,2,3,4,4,4-octafluoro-2-methoxy-3-(trifluoromethyl)butane (PubChem CID 22987398) has the molecular formula C6H3F11O and a molecular weight of 300.07 g/mol. Its IUPAC name is 1,1,1,2,3,4,4,4-octafluoro-2-methoxy-3-(trifluoromethyl)butane.
| Compound Name | 1,1,1,2,3,4,4,4-octafluoro-2-methoxy-3-(trifluoromethyl)butane |
|---|---|
| PubChem CID | 22987398 |
| Molecular Formula | C6H3F11O |
| Molecular Weight | 300.07 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 1,1,1,2,3,4,4,4-octafluoro-2-methoxy-3-(trifluoromethyl)butane |
| SMILES | COC(F)(C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H3F11O/c1-18-3(8,6(15,16)17)2(7,4(9,10)11)5(12,13)14/h1H3 |
| InChIKey | CRJUWMHHXMZFHE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.07 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |