C9H12N4NaS2+ — CID 22987620
sodium 6-[bis(prop-2-enyl)amino]-1H-1,3,5-triazine-2,4-dithione (PubChem CID 22987620) has the molecular formula C9H12N4NaS2+ and a molecular weight of 263.35 g/mol. Its IUPAC name is sodium 6-[bis(prop-2-enyl)amino]-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | sodium 6-[bis(prop-2-enyl)amino]-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 22987620 |
| Molecular Formula | C9H12N4NaS2+ |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | sodium 6-[bis(prop-2-enyl)amino]-1H-1,3,5-triazine-2,4-dithione |
| SMILES | C=CCN(CC=C)c1nc(=S)[nH]c(=S)[nH]1.[Na+] |
| InChI | InChI=1S/C9H12N4S2.Na/c1-3-5-13(6-4-2)7-10-8(14)12-9(15)11-7;/h3-4H,1-2,5-6H2,(H2,10,11,12,14,15);/q;+1 |
| InChIKey | UFOXGLNDELQXTI-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|