About 2-amino-2-ethylbutan-1-ol;2H-benzotriazole
2-amino-2-ethylbutan-1-ol;2H-benzotriazole (PubChem CID 22987674) has the molecular formula C12H20N4O
and a molecular weight of 236.32 g/mol. Its IUPAC name is 2-amino-2-ethylbutan-1-ol;2H-benzotriazole.
Molecular Properties
| Compound Name | 2-amino-2-ethylbutan-1-ol;2H-benzotriazole |
| PubChem CID | 22987674 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2-amino-2-ethylbutan-1-ol;2H-benzotriazole |
| SMILES | CCC(N)(CC)CO.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C6H5N3.C6H15NO/c1-2-4-6-5(3-1)7-9-8-6;1-3-6(7,4-2)5-8/h1-4H,(H,7,8,9);8H,3-5,7H2,1-2H3 |
| InChIKey | YOTBIQNNLTZKEM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-2-ethylbutan-1-ol;2H-benzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-ethylbutan-1-ol;2H-benzotriazole?
The IUPAC name of 2-amino-2-ethylbutan-1-ol;2H-benzotriazole (CID 22987674) is 2-amino-2-ethylbutan-1-ol;2H-benzotriazole.
What is the SMILES notation for 2-amino-2-ethylbutan-1-ol;2H-benzotriazole?
The canonical SMILES for 2-amino-2-ethylbutan-1-ol;2H-benzotriazole is CCC(N)(CC)CO.c1ccc2n[nH]nc2c1.
What is the InChIKey of 2-amino-2-ethylbutan-1-ol;2H-benzotriazole?
The InChIKey is YOTBIQNNLTZKEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.C6H15NO/c1-2-4-6-5(3-1)7-9-8-6;1-3-6(7,4-2)5-8/h1-4H,(H,7,8,9);8H,3-5,7H2,1-2H3.
What are the key properties of 2-amino-2-ethylbutan-1-ol;2H-benzotriazole?
2-amino-2-ethylbutan-1-ol;2H-benzotriazole has a molecular weight of 236.32 g/mol, XLogP of 1.45, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-ethylbutan-1-ol;2H-benzotriazole is sourced from PubChem (CID 22987674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).