About 1-hydroxypyrrolo[3,2-b]pyridine
1-hydroxypyrrolo[3,2-b]pyridine (PubChem CID 22988006) has the molecular formula C7H6N2O
and a molecular weight of 134.14 g/mol. Its IUPAC name is 1-hydroxypyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 1-hydroxypyrrolo[3,2-b]pyridine |
| PubChem CID | 22988006 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 1-hydroxypyrrolo[3,2-b]pyridine |
| SMILES | On1ccc2ncccc21 |
| InChI | InChI=1S/C7H6N2O/c10-9-5-3-6-7(9)2-1-4-8-6/h1-5,10H |
| InChIKey | VTFHVPUSLDJAFV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypyrrolo[3,2-b]pyridine?
The IUPAC name of 1-hydroxypyrrolo[3,2-b]pyridine (CID 22988006) is 1-hydroxypyrrolo[3,2-b]pyridine.
What is the SMILES notation for 1-hydroxypyrrolo[3,2-b]pyridine?
The canonical SMILES for 1-hydroxypyrrolo[3,2-b]pyridine is On1ccc2ncccc21.
What is the InChIKey of 1-hydroxypyrrolo[3,2-b]pyridine?
The InChIKey is VTFHVPUSLDJAFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O/c10-9-5-3-6-7(9)2-1-4-8-6/h1-5,10H.
What are the key properties of 1-hydroxypyrrolo[3,2-b]pyridine?
1-hydroxypyrrolo[3,2-b]pyridine has a molecular weight of 134.14 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypyrrolo[3,2-b]pyridine is sourced from PubChem (CID 22988006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).