About 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid
1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid (PubChem CID 22988302) has the molecular formula C25H17F6NO3
and a molecular weight of 493.40 g/mol. Its IUPAC name is 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid |
| PubChem CID | 22988302 |
| Molecular Formula | C25H17F6NO3 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(OCc3ccccc3)ccc2n1Cc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H17F6NO3/c26-24(27,28)18-7-6-16(20(12-18)25(29,30)31)13-32-21-9-8-19(10-17(21)11-22(32)23(33)34)35-14-15-4-2-1-3-5-15/h1-12H,13-14H2,(H,33,34) |
| InChIKey | NFNQMVOXPQKBGZ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid?
The IUPAC name of 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid (CID 22988302) is 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid.
What is the SMILES notation for 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid?
The canonical SMILES for 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid is O=C(O)c1cc2cc(OCc3ccccc3)ccc2n1Cc1ccc(C(F)(F)F)cc1C(F)(F)F.
What is the InChIKey of 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid?
The InChIKey is NFNQMVOXPQKBGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H17F6NO3/c26-24(27,28)18-7-6-16(20(12-18)25(29,30)31)13-32-21-9-8-19(10-17(21)11-22(32)23(33)34)35-14-15-4-2-1-3-5-15/h1-12H,13-14H2,(H,33,34).
What are the key properties of 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid?
1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid has a molecular weight of 493.40 g/mol, XLogP of 7.00, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-5-phenylmethoxyindole-2-carboxylic acid is sourced from PubChem (CID 22988302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).