C24H26NOS+ — CID 2298833
1-phenyl-2-[2-[2-(4-propan-2-ylphenyl)sulfanylethyl]pyridin-1-ium-1-yl]ethanone (PubChem CID 2298833) has the molecular formula C24H26NOS+ and a molecular weight of 376.55 g/mol. Its IUPAC name is 1-phenyl-2-[2-[2-(4-propan-2-ylphenyl)sulfanylethyl]pyridin-1-ium-1-yl]ethanone.
| Compound Name | 1-phenyl-2-[2-[2-(4-propan-2-ylphenyl)sulfanylethyl]pyridin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 2298833 |
| Molecular Formula | C24H26NOS+ |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-phenyl-2-[2-[2-(4-propan-2-ylphenyl)sulfanylethyl]pyridin-1-ium-1-yl]ethanone |
| SMILES | CC(C)c1ccc(SCCc2cccc[n+]2CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H26NOS/c1-19(2)20-11-13-23(14-12-20)27-17-15-22-10-6-7-16-25(22)18-24(26)21-8-4-3-5-9-21/h3-14,16,19H,15,17-18H2,1-2H3/q+1 |
| InChIKey | QDBCLLDOTJGGDN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|