About 3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile
3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile (PubChem CID 22988620) has the molecular formula C9H22N3O2P
and a molecular weight of 235.27 g/mol. Its IUPAC name is 3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile.
Molecular Properties
| Compound Name | 3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile |
| PubChem CID | 22988620 |
| Molecular Formula | C9H22N3O2P |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile |
| SMILES | CC(C)N(C(C)C)P(N)(O)(O)CCC#N |
| InChI | InChI=1S/C9H22N3O2P/c1-8(2)12(9(3)4)15(11,13,14)7-5-6-10/h8-9,13-14H,5,7,11H2,1-4H3 |
| InChIKey | KRRGWXQMGCKBMD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile?
The IUPAC name of 3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile (CID 22988620) is 3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile.
What is the SMILES notation for 3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile?
The canonical SMILES for 3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile is CC(C)N(C(C)C)P(N)(O)(O)CCC#N.
What is the InChIKey of 3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile?
The InChIKey is KRRGWXQMGCKBMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N3O2P/c1-8(2)12(9(3)4)15(11,13,14)7-5-6-10/h8-9,13-14H,5,7,11H2,1-4H3.
What are the key properties of 3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile?
3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile has a molecular weight of 235.27 g/mol, XLogP of 1.18, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[amino-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile is sourced from PubChem (CID 22988620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).