About 2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid
2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid (PubChem CID 22988674) has the molecular formula C16H30O6
and a molecular weight of 318.41 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid.
Molecular Properties
| Compound Name | 2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid |
| PubChem CID | 22988674 |
| Molecular Formula | C16H30O6 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid |
| SMILES | CC(C)OC(C(=O)O)(C(C)C)C(OC(C)C)(C(=O)O)C(C)C |
| InChI | InChI=1S/C16H30O6/c1-9(2)15(13(17)18,21-11(5)6)16(10(3)4,14(19)20)22-12(7)8/h9-12H,1-8H3,(H,17,18)(H,19,20) |
| InChIKey | AACPLRMNVWOYCH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid?
The IUPAC name of 2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid (CID 22988674) is 2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid.
What is the SMILES notation for 2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid?
The canonical SMILES for 2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid is CC(C)OC(C(=O)O)(C(C)C)C(OC(C)C)(C(=O)O)C(C)C.
What is the InChIKey of 2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid?
The InChIKey is AACPLRMNVWOYCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O6/c1-9(2)15(13(17)18,21-11(5)6)16(10(3)4,14(19)20)22-12(7)8/h9-12H,1-8H3,(H,17,18)(H,19,20).
What are the key properties of 2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid?
2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid has a molecular weight of 318.41 g/mol, XLogP of 2.80, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(propan-2-yl)-2,3-di(propan-2-yloxy)butanedioic acid is sourced from PubChem (CID 22988674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).