About 2,3-dimethyl-4H-pyran
2,3-dimethyl-4H-pyran (PubChem CID 22988881) has the molecular formula C7H10O
and a molecular weight of 110.16 g/mol. Its IUPAC name is 2,3-dimethyl-4H-pyran.
Molecular Properties
| Compound Name | 2,3-dimethyl-4H-pyran |
| PubChem CID | 22988881 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | 2,3-dimethyl-4H-pyran |
| SMILES | CC1=C(C)OC=CC1 |
| InChI | InChI=1S/C7H10O/c1-6-4-3-5-8-7(6)2/h3,5H,4H2,1-2H3 |
| InChIKey | DUWFBXLAUZEBAM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethyl-4H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4H-pyran?
The IUPAC name of 2,3-dimethyl-4H-pyran (CID 22988881) is 2,3-dimethyl-4H-pyran.
What is the SMILES notation for 2,3-dimethyl-4H-pyran?
The canonical SMILES for 2,3-dimethyl-4H-pyran is CC1=C(C)OC=CC1.
What is the InChIKey of 2,3-dimethyl-4H-pyran?
The InChIKey is DUWFBXLAUZEBAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O/c1-6-4-3-5-8-7(6)2/h3,5H,4H2,1-2H3.
What are the key properties of 2,3-dimethyl-4H-pyran?
2,3-dimethyl-4H-pyran has a molecular weight of 110.16 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4H-pyran is sourced from PubChem (CID 22988881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).