About methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate
methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate (PubChem CID 22989942) has the molecular formula C19H17FO5S
and a molecular weight of 376.41 g/mol. Its IUPAC name is methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate |
| PubChem CID | 22989942 |
| Molecular Formula | C19H17FO5S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate |
| SMILES | COC(=O)C1=Cc2cc(OCc3ccc(F)cc3)ccc2S(=O)(=O)CC1 |
| InChI | InChI=1S/C19H17FO5S/c1-24-19(21)14-8-9-26(22,23)18-7-6-17(11-15(18)10-14)25-12-13-2-4-16(20)5-3-13/h2-7,10-11H,8-9,12H2,1H3 |
| InChIKey | LTJUCRZUGFHKNR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate?
The IUPAC name of methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate (CID 22989942) is methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate.
What is the SMILES notation for methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate?
The canonical SMILES for methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate is COC(=O)C1=Cc2cc(OCc3ccc(F)cc3)ccc2S(=O)(=O)CC1.
What is the InChIKey of methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate?
The InChIKey is LTJUCRZUGFHKNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FO5S/c1-24-19(21)14-8-9-26(22,23)18-7-6-17(11-15(18)10-14)25-12-13-2-4-16(20)5-3-13/h2-7,10-11H,8-9,12H2,1H3.
What are the key properties of methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate?
methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate has a molecular weight of 376.41 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(4-fluorophenyl)methoxy]-1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate is sourced from PubChem (CID 22989942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).