C23H26O6S — CID 22989958
methyl 1,1-dioxo-7-[[4-(propoxymethyl)phenyl]methoxy]-2,3-dihydro-1λ6-benzothiepine-4-carboxylate (PubChem CID 22989958) has the molecular formula C23H26O6S and a molecular weight of 430.52 g/mol. Its IUPAC name is methyl 1,1-dioxo-7-[[4-(propoxymethyl)phenyl]methoxy]-2,3-dihydro-1λ6-benzothiepine-4-carboxylate.
| Compound Name | methyl 1,1-dioxo-7-[[4-(propoxymethyl)phenyl]methoxy]-2,3-dihydro-1λ6-benzothiepine-4-carboxylate |
|---|---|
| PubChem CID | 22989958 |
| Molecular Formula | C23H26O6S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | methyl 1,1-dioxo-7-[[4-(propoxymethyl)phenyl]methoxy]-2,3-dihydro-1λ6-benzothiepine-4-carboxylate |
| SMILES | CCCOCc1ccc(COc2ccc3c(c2)C=C(C(=O)OC)CCS3(=O)=O)cc1 |
| InChI | InChI=1S/C23H26O6S/c1-3-11-28-15-17-4-6-18(7-5-17)16-29-21-8-9-22-20(14-21)13-19(23(24)27-2)10-12-30(22,25)26/h4-9,13-14H,3,10-12,15-16H2,1-2H3 |
| InChIKey | LWPIMJPKLNYJQQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|