About acetonitrile;ethyl 3-hydroxypropanoate
acetonitrile;ethyl 3-hydroxypropanoate (PubChem CID 22990060) has the molecular formula C7H13NO3
and a molecular weight of 159.19 g/mol. Its IUPAC name is acetonitrile;ethyl 3-hydroxypropanoate.
Molecular Properties
| Compound Name | acetonitrile;ethyl 3-hydroxypropanoate |
| PubChem CID | 22990060 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | acetonitrile;ethyl 3-hydroxypropanoate |
| SMILES | CC#N.CCOC(=O)CCO |
| InChI | InChI=1S/C5H10O3.C2H3N/c1-2-8-5(7)3-4-6;1-2-3/h6H,2-4H2,1H3;1H3 |
| InChIKey | QDFWSOIMMMZKHJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetonitrile;ethyl 3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;ethyl 3-hydroxypropanoate?
The IUPAC name of acetonitrile;ethyl 3-hydroxypropanoate (CID 22990060) is acetonitrile;ethyl 3-hydroxypropanoate.
What is the SMILES notation for acetonitrile;ethyl 3-hydroxypropanoate?
The canonical SMILES for acetonitrile;ethyl 3-hydroxypropanoate is CC#N.CCOC(=O)CCO.
What is the InChIKey of acetonitrile;ethyl 3-hydroxypropanoate?
The InChIKey is QDFWSOIMMMZKHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.C2H3N/c1-2-8-5(7)3-4-6;1-2-3/h6H,2-4H2,1H3;1H3.
What are the key properties of acetonitrile;ethyl 3-hydroxypropanoate?
acetonitrile;ethyl 3-hydroxypropanoate has a molecular weight of 159.19 g/mol, XLogP of 0.46, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;ethyl 3-hydroxypropanoate is sourced from PubChem (CID 22990060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).