About 3-(5,8,8-trimethyldodecan-5-yl)dioxirane
3-(5,8,8-trimethyldodecan-5-yl)dioxirane (PubChem CID 22990318) has the molecular formula C16H32O2
and a molecular weight of 256.43 g/mol. Its IUPAC name is 3-(5,8,8-trimethyldodecan-5-yl)dioxirane.
Molecular Properties
| Compound Name | 3-(5,8,8-trimethyldodecan-5-yl)dioxirane |
| PubChem CID | 22990318 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 3-(5,8,8-trimethyldodecan-5-yl)dioxirane |
| SMILES | CCCCC(C)(C)CCC(C)(CCCC)C1OO1 |
| InChI | InChI=1S/C16H32O2/c1-6-8-10-15(3,4)12-13-16(5,11-9-7-2)14-17-18-14/h14H,6-13H2,1-5H3 |
| InChIKey | ZLUFKBUKSBJZKB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-(5,8,8-trimethyldodecan-5-yl)dioxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5,8,8-trimethyldodecan-5-yl)dioxirane?
The IUPAC name of 3-(5,8,8-trimethyldodecan-5-yl)dioxirane (CID 22990318) is 3-(5,8,8-trimethyldodecan-5-yl)dioxirane.
What is the SMILES notation for 3-(5,8,8-trimethyldodecan-5-yl)dioxirane?
The canonical SMILES for 3-(5,8,8-trimethyldodecan-5-yl)dioxirane is CCCCC(C)(C)CCC(C)(CCCC)C1OO1.
What is the InChIKey of 3-(5,8,8-trimethyldodecan-5-yl)dioxirane?
The InChIKey is ZLUFKBUKSBJZKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2/c1-6-8-10-15(3,4)12-13-16(5,11-9-7-2)14-17-18-14/h14H,6-13H2,1-5H3.
What are the key properties of 3-(5,8,8-trimethyldodecan-5-yl)dioxirane?
3-(5,8,8-trimethyldodecan-5-yl)dioxirane has a molecular weight of 256.43 g/mol, XLogP of 5.47, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,8,8-trimethyldodecan-5-yl)dioxirane is sourced from PubChem (CID 22990318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).