C28H30ClN3O2S — CID 22990697
2-amino-N-[2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]ethyl]benzenesulfonamide;hydrochloride (PubChem CID 22990697) has the molecular formula C28H30ClN3O2S and a molecular weight of 508.09 g/mol. Its IUPAC name is 2-amino-N-[2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 2-amino-N-[2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22990697 |
| Molecular Formula | C28H30ClN3O2S |
| Molecular Weight | 508.09 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 2-amino-N-[2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]ethyl]benzenesulfonamide;hydrochloride |
| SMILES | Cl.Nc1ccccc1S(=O)(=O)NCCN1CCC(=C2c3ccccc3C=Cc3ccccc32)CC1 |
| InChI | InChI=1S/C28H29N3O2S.ClH/c29-26-11-5-6-12-27(26)34(32,33)30-17-20-31-18-15-23(16-19-31)28-24-9-3-1-7-21(24)13-14-22-8-2-4-10-25(22)28;/h1-14,30H,15-20,29H2;1H |
| InChIKey | MOHRTPBVAZTTFR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.09 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|