C38H44N2O2 — CID 22990996
2-(3,4-dimethoxyphenyl)-2-[3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]propyl]heptanenitrile (PubChem CID 22990996) has the molecular formula C38H44N2O2 and a molecular weight of 560.78 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-2-[3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]propyl]heptanenitrile.
| Compound Name | 2-(3,4-dimethoxyphenyl)-2-[3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]propyl]heptanenitrile |
|---|---|
| PubChem CID | 22990996 |
| Molecular Formula | C38H44N2O2 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2-[3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]propyl]heptanenitrile |
| SMILES | CCCCCC(C#N)(CCCN1CCC(=C2c3ccccc3C=Cc3ccccc32)CC1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C38H44N2O2/c1-4-5-10-22-38(28-39,32-18-19-35(41-2)36(27-32)42-3)23-11-24-40-25-20-31(21-26-40)37-33-14-8-6-12-29(33)16-17-30-13-7-9-15-34(30)37/h6-9,12-19,27H,4-5,10-11,20-26H2,1-3H3 |
| InChIKey | WYDZVDSNVURSNV-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|