2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid

C12H18N2O4S — CID 22991801

IUPAC2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid
SMILESCC(C)c1ccc(S(=O)(=O)C(N)(CN)C(=O)O)cc1
InChIInChI=1S/C12H18N2O4S/c1-8(2)9-3-5-10(6-4-9)19(17,18)12(14,7-13)11(15)16/h3-6,8H,7,13-14H2,1-2H3,(H,15,16)
InChIKeyAWRHNNIQLDZLPL-UHFFFAOYSA-N
MW286.35 g/mol
LogP0.28
Rot. Bonds5

About 2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid

2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid (PubChem CID 22991801) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid.

Molecular Properties

Compound Name2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid
PubChem CID22991801
Molecular FormulaC12H18N2O4S
Molecular Weight286.35 g/mol
Exact Mass286.10
IUPAC Name2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid
SMILESCC(C)c1ccc(S(=O)(=O)C(N)(CN)C(=O)O)cc1
InChIInChI=1S/C12H18N2O4S/c1-8(2)9-3-5-10(6-4-9)19(17,18)12(14,7-13)11(15)16/h3-6,8H,7,13-14H2,1-2H3,(H,15,16)
InChIKeyAWRHNNIQLDZLPL-UHFFFAOYSA-N
XLogP0.28
TPSA123.48 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.35
LogP ≤ 50.28
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid?
The IUPAC name of 2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid (CID 22991801) is 2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid.
What is the SMILES notation for 2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid?
The canonical SMILES for 2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid is CC(C)c1ccc(S(=O)(=O)C(N)(CN)C(=O)O)cc1.
What is the InChIKey of 2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid?
The InChIKey is AWRHNNIQLDZLPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O4S/c1-8(2)9-3-5-10(6-4-9)19(17,18)12(14,7-13)11(15)16/h3-6,8H,7,13-14H2,1-2H3,(H,15,16).
What are the key properties of 2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid?
2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid has a molecular weight of 286.35 g/mol, XLogP of 0.28, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diamino-2-(4-propan-2-ylphenyl)sulfonylpropanoic acid is sourced from PubChem (CID 22991801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).