About 2H-1,2-benzoxazin-3-ol
2H-1,2-benzoxazin-3-ol (PubChem CID 22992156) has the molecular formula C8H7NO2
and a molecular weight of 149.15 g/mol. Its IUPAC name is 2H-1,2-benzoxazin-3-ol.
Molecular Properties
| Compound Name | 2H-1,2-benzoxazin-3-ol |
| PubChem CID | 22992156 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 2H-1,2-benzoxazin-3-ol |
| SMILES | OC1=Cc2ccccc2ON1 |
| InChI | InChI=1S/C8H7NO2/c10-8-5-6-3-1-2-4-7(6)11-9-8/h1-5,9-10H |
| InChIKey | SNONAWYBSWWKSX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-1,2-benzoxazin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,2-benzoxazin-3-ol?
The IUPAC name of 2H-1,2-benzoxazin-3-ol (CID 22992156) is 2H-1,2-benzoxazin-3-ol.
What is the SMILES notation for 2H-1,2-benzoxazin-3-ol?
The canonical SMILES for 2H-1,2-benzoxazin-3-ol is OC1=Cc2ccccc2ON1.
What is the InChIKey of 2H-1,2-benzoxazin-3-ol?
The InChIKey is SNONAWYBSWWKSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2/c10-8-5-6-3-1-2-4-7(6)11-9-8/h1-5,9-10H.
What are the key properties of 2H-1,2-benzoxazin-3-ol?
2H-1,2-benzoxazin-3-ol has a molecular weight of 149.15 g/mol, XLogP of 1.44, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,2-benzoxazin-3-ol is sourced from PubChem (CID 22992156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).