About 2-oxido-4H-1,2-benzoxazin-2-ium-3-one
2-oxido-4H-1,2-benzoxazin-2-ium-3-one (PubChem CID 22992172) has the molecular formula C8H7NO3
and a molecular weight of 165.15 g/mol. Its IUPAC name is 2-oxido-4H-1,2-benzoxazin-2-ium-3-one.
Molecular Properties
| Compound Name | 2-oxido-4H-1,2-benzoxazin-2-ium-3-one |
| PubChem CID | 22992172 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 2-oxido-4H-1,2-benzoxazin-2-ium-3-one |
| SMILES | O=C1Cc2ccccc2O[NH+]1[O-] |
| InChI | InChI=1S/C8H7NO3/c10-8-5-6-3-1-2-4-7(6)12-9(8)11/h1-4,9H,5H2 |
| InChIKey | DSUNAHXKAQPOED-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 53.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxido-4H-1,2-benzoxazin-2-ium-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxido-4H-1,2-benzoxazin-2-ium-3-one?
The IUPAC name of 2-oxido-4H-1,2-benzoxazin-2-ium-3-one (CID 22992172) is 2-oxido-4H-1,2-benzoxazin-2-ium-3-one.
What is the SMILES notation for 2-oxido-4H-1,2-benzoxazin-2-ium-3-one?
The canonical SMILES for 2-oxido-4H-1,2-benzoxazin-2-ium-3-one is O=C1Cc2ccccc2O[NH+]1[O-].
What is the InChIKey of 2-oxido-4H-1,2-benzoxazin-2-ium-3-one?
The InChIKey is DSUNAHXKAQPOED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3/c10-8-5-6-3-1-2-4-7(6)12-9(8)11/h1-4,9H,5H2.
What are the key properties of 2-oxido-4H-1,2-benzoxazin-2-ium-3-one?
2-oxido-4H-1,2-benzoxazin-2-ium-3-one has a molecular weight of 165.15 g/mol, XLogP of -0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxido-4H-1,2-benzoxazin-2-ium-3-one is sourced from PubChem (CID 22992172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).