C12H14N2O3 — CID 22992373
N-(2-nitro-5,6,7,8-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 22992373) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is N-(2-nitro-5,6,7,8-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | N-(2-nitro-5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 22992373 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | N-(2-nitro-5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | CC(=O)Nc1c([N+](=O)[O-])ccc2c1CCCC2 |
| InChI | InChI=1S/C12H14N2O3/c1-8(15)13-12-10-5-3-2-4-9(10)6-7-11(12)14(16)17/h6-7H,2-5H2,1H3,(H,13,15) |
| InChIKey | QWMFLYBAEHSFLC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|