About Allyldiethylsilane
Allyldiethylsilane (PubChem CID 22992661) has the molecular formula C7H15Si
and a molecular weight of 127.28 g/mol.
Molecular Properties
| Compound Name | Allyldiethylsilane |
| PubChem CID | 22992661 |
| Molecular Formula | C7H15Si |
| Molecular Weight | 127.28 g/mol |
| Exact Mass | 127.09 |
| IUPAC Name | — |
| SMILES | C=CC[Si](CC)CC |
| InChI | InChI=1S/C7H15Si/c1-4-7-8(5-2)6-3/h4H,1,5-7H2,2-3H3 |
| InChIKey | HZIHQTHDSWPYAU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Allyldiethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Allyldiethylsilane?
The IUPAC name of Allyldiethylsilane (CID 22992661) is not available.
What is the SMILES notation for Allyldiethylsilane?
The canonical SMILES for Allyldiethylsilane is C=CC[Si](CC)CC.
What is the InChIKey of Allyldiethylsilane?
The InChIKey is HZIHQTHDSWPYAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15Si/c1-4-7-8(5-2)6-3/h4H,1,5-7H2,2-3H3.
What are the key properties of Allyldiethylsilane?
Allyldiethylsilane has a molecular weight of 127.28 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Allyldiethylsilane is sourced from PubChem (CID 22992661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).