About pyrrolidin-1-yl benzoate
pyrrolidin-1-yl benzoate (PubChem CID 22992933) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is pyrrolidin-1-yl benzoate.
Molecular Properties
| Compound Name | pyrrolidin-1-yl benzoate |
| PubChem CID | 22992933 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | pyrrolidin-1-yl benzoate |
| SMILES | O=C(ON1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C11H13NO2/c13-11(10-6-2-1-3-7-10)14-12-8-4-5-9-12/h1-3,6-7H,4-5,8-9H2 |
| InChIKey | RAUHJDNJJQYPED-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolidin-1-yl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-1-yl benzoate?
The IUPAC name of pyrrolidin-1-yl benzoate (CID 22992933) is pyrrolidin-1-yl benzoate.
What is the SMILES notation for pyrrolidin-1-yl benzoate?
The canonical SMILES for pyrrolidin-1-yl benzoate is O=C(ON1CCCC1)c1ccccc1.
What is the InChIKey of pyrrolidin-1-yl benzoate?
The InChIKey is RAUHJDNJJQYPED-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c13-11(10-6-2-1-3-7-10)14-12-8-4-5-9-12/h1-3,6-7H,4-5,8-9H2.
What are the key properties of pyrrolidin-1-yl benzoate?
pyrrolidin-1-yl benzoate has a molecular weight of 191.23 g/mol, XLogP of 1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-1-yl benzoate is sourced from PubChem (CID 22992933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).