About 4,4-diethylmorpholin-4-ium;ethyl sulfate
4,4-diethylmorpholin-4-ium;ethyl sulfate (PubChem CID 22993116) has the molecular formula C10H23NO5S
and a molecular weight of 269.36 g/mol. Its IUPAC name is 4,4-diethylmorpholin-4-ium;ethyl sulfate.
Molecular Properties
| Compound Name | 4,4-diethylmorpholin-4-ium;ethyl sulfate |
| PubChem CID | 22993116 |
| Molecular Formula | C10H23NO5S |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4,4-diethylmorpholin-4-ium;ethyl sulfate |
| SMILES | CCOS(=O)(=O)[O-].CC[N+]1(CC)CCOCC1 |
| InChI | InChI=1S/C8H18NO.C2H6O4S/c1-3-9(4-2)5-7-10-8-6-9;1-2-6-7(3,4)5/h3-8H2,1-2H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | OGTHHSMYAUDJMT-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diethylmorpholin-4-ium;ethyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diethylmorpholin-4-ium;ethyl sulfate?
The IUPAC name of 4,4-diethylmorpholin-4-ium;ethyl sulfate (CID 22993116) is 4,4-diethylmorpholin-4-ium;ethyl sulfate.
What is the SMILES notation for 4,4-diethylmorpholin-4-ium;ethyl sulfate?
The canonical SMILES for 4,4-diethylmorpholin-4-ium;ethyl sulfate is CCOS(=O)(=O)[O-].CC[N+]1(CC)CCOCC1.
What is the InChIKey of 4,4-diethylmorpholin-4-ium;ethyl sulfate?
The InChIKey is OGTHHSMYAUDJMT-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18NO.C2H6O4S/c1-3-9(4-2)5-7-10-8-6-9;1-2-6-7(3,4)5/h3-8H2,1-2H3;2H2,1H3,(H,3,4,5)/q+1;/p-1.
What are the key properties of 4,4-diethylmorpholin-4-ium;ethyl sulfate?
4,4-diethylmorpholin-4-ium;ethyl sulfate has a molecular weight of 269.36 g/mol, XLogP of 0.36, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diethylmorpholin-4-ium;ethyl sulfate is sourced from PubChem (CID 22993116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).