C14H20F4O2 — CID 22993217
ethyl 2,2,3,3-tetrafluoro-3-(4-propylcyclohexen-1-yl)propanoate (PubChem CID 22993217) has the molecular formula C14H20F4O2 and a molecular weight of 296.30 g/mol. Its IUPAC name is ethyl 2,2,3,3-tetrafluoro-3-(4-propylcyclohexen-1-yl)propanoate.
| Compound Name | ethyl 2,2,3,3-tetrafluoro-3-(4-propylcyclohexen-1-yl)propanoate |
|---|---|
| PubChem CID | 22993217 |
| Molecular Formula | C14H20F4O2 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | ethyl 2,2,3,3-tetrafluoro-3-(4-propylcyclohexen-1-yl)propanoate |
| SMILES | CCCC1CC=C(C(F)(F)C(F)(F)C(=O)OCC)CC1 |
| InChI | InChI=1S/C14H20F4O2/c1-3-5-10-6-8-11(9-7-10)13(15,16)14(17,18)12(19)20-4-2/h8,10H,3-7,9H2,1-2H3 |
| InChIKey | SZSDMTIGAPBQHB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|