C10H8F6O — CID 22993249
1,1,2-trifluoro-3-(1,1,2-trifluoropenta-1,4-dien-3-yloxy)penta-1,4-diene (PubChem CID 22993249) has the molecular formula C10H8F6O and a molecular weight of 258.16 g/mol. Its IUPAC name is 1,1,2-trifluoro-3-(1,1,2-trifluoropenta-1,4-dien-3-yloxy)penta-1,4-diene.
| Compound Name | 1,1,2-trifluoro-3-(1,1,2-trifluoropenta-1,4-dien-3-yloxy)penta-1,4-diene |
|---|---|
| PubChem CID | 22993249 |
| Molecular Formula | C10H8F6O |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 1,1,2-trifluoro-3-(1,1,2-trifluoropenta-1,4-dien-3-yloxy)penta-1,4-diene |
| SMILES | C=CC(OC(C=C)C(F)=C(F)F)C(F)=C(F)F |
| InChI | InChI=1S/C10H8F6O/c1-3-5(7(11)9(13)14)17-6(4-2)8(12)10(15)16/h3-6H,1-2H2 |
| InChIKey | KDHJUUQRUFSQLW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|