About oxolane;tri(propan-2-yloxy)alumane
oxolane;tri(propan-2-yloxy)alumane (PubChem CID 22993282) has the molecular formula C13H29AlO4
and a molecular weight of 276.35 g/mol. Its IUPAC name is oxolane;tri(propan-2-yloxy)alumane.
Molecular Properties
| Compound Name | oxolane;tri(propan-2-yloxy)alumane |
| PubChem CID | 22993282 |
| Molecular Formula | C13H29AlO4 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | oxolane;tri(propan-2-yloxy)alumane |
| SMILES | C1CCOC1.CC(C)O[Al](OC(C)C)OC(C)C |
| InChI | InChI=1S/C4H8O.3C3H7O.Al/c1-2-4-5-3-1;3*1-3(2)4;/h1-4H2;3*3H,1-2H3;/q;3*-1;+3 |
| InChIKey | XLBGSDDYCUUJTC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze oxolane;tri(propan-2-yloxy)alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolane;tri(propan-2-yloxy)alumane?
The IUPAC name of oxolane;tri(propan-2-yloxy)alumane (CID 22993282) is oxolane;tri(propan-2-yloxy)alumane.
What is the SMILES notation for oxolane;tri(propan-2-yloxy)alumane?
The canonical SMILES for oxolane;tri(propan-2-yloxy)alumane is C1CCOC1.CC(C)O[Al](OC(C)C)OC(C)C.
What is the InChIKey of oxolane;tri(propan-2-yloxy)alumane?
The InChIKey is XLBGSDDYCUUJTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.3C3H7O.Al/c1-2-4-5-3-1;3*1-3(2)4;/h1-4H2;3*3H,1-2H3;/q;3*-1;+3.
What are the key properties of oxolane;tri(propan-2-yloxy)alumane?
oxolane;tri(propan-2-yloxy)alumane has a molecular weight of 276.35 g/mol, XLogP of 3.04, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane;tri(propan-2-yloxy)alumane is sourced from PubChem (CID 22993282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).