C26H27F2N3O2 — CID 22993488
1-[(E)-5-[4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]pent-3-enyl]-4-phenylpiperidine-4-carbonitrile (PubChem CID 22993488) has the molecular formula C26H27F2N3O2 and a molecular weight of 451.52 g/mol. Its IUPAC name is 1-[(E)-5-[4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]pent-3-enyl]-4-phenylpiperidine-4-carbonitrile.
| Compound Name | 1-[(E)-5-[4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]pent-3-enyl]-4-phenylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 22993488 |
| Molecular Formula | C26H27F2N3O2 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 1-[(E)-5-[4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]pent-3-enyl]-4-phenylpiperidine-4-carbonitrile |
| SMILES | N#CC1(c2ccccc2)CCN(CC/C=C/CN2C(=O)OCC2c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C26H27F2N3O2/c27-22-10-9-20(17-23(22)28)24-18-33-25(32)31(24)14-6-2-5-13-30-15-11-26(19-29,12-16-30)21-7-3-1-4-8-21/h1-4,6-10,17,24H,5,11-16,18H2/b6-2+ |
| InChIKey | BSTOFRVRBDEEOG-QHHAFSJGSA-N |
| XLogP | 4.96 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|