C16H26N4O6 — CID 22993655
tert-butyl 3-(2-amino-3-methoxy-3-oxopropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 22993655) has the molecular formula C16H26N4O6 and a molecular weight of 370.41 g/mol. Its IUPAC name is tert-butyl 3-(2-amino-3-methoxy-3-oxopropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 3-(2-amino-3-methoxy-3-oxopropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 22993655 |
| Molecular Formula | C16H26N4O6 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | tert-butyl 3-(2-amino-3-methoxy-3-oxopropyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | COC(=O)C(N)CN1C(=O)NC2(CCN(C(=O)OC(C)(C)C)CC2)C1=O |
| InChI | InChI=1S/C16H26N4O6/c1-15(2,3)26-14(24)19-7-5-16(6-8-19)12(22)20(13(23)18-16)9-10(17)11(21)25-4/h10H,5-9,17H2,1-4H3,(H,18,23) |
| InChIKey | JGFZHLAMRFODDZ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|